C14H15ClN4O2 — CID 115434568
1-[[5-(2-chlorophenyl)tetrazol-1-yl]methyl]cyclopentane-1-carboxylic acid (PubChem CID 115434568) has the molecular formula C14H15ClN4O2 and a molecular weight of 306.75 g/mol. Its IUPAC name is 1-[[5-(2-chlorophenyl)tetrazol-1-yl]methyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[[5-(2-chlorophenyl)tetrazol-1-yl]methyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 115434568 |
| Molecular Formula | C14H15ClN4O2 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 1-[[5-(2-chlorophenyl)tetrazol-1-yl]methyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1(Cn2nnnc2-c2ccccc2Cl)CCCC1 |
| InChI | InChI=1S/C14H15ClN4O2/c15-11-6-2-1-5-10(11)12-16-17-18-19(12)9-14(13(20)21)7-3-4-8-14/h1-2,5-6H,3-4,7-9H2,(H,20,21) |
| InChIKey | IQVMRIUQDNUDPW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |