C12H14N6O2 — CID 102923004
1-[(5-pyrimidin-5-yltetrazol-1-yl)methyl]cyclopentane-1-carboxylic acid (PubChem CID 102923004) has the molecular formula C12H14N6O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is 1-[(5-pyrimidin-5-yltetrazol-1-yl)methyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[(5-pyrimidin-5-yltetrazol-1-yl)methyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 102923004 |
| Molecular Formula | C12H14N6O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 1-[(5-pyrimidin-5-yltetrazol-1-yl)methyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1(Cn2nnnc2-c2cncnc2)CCCC1 |
| InChI | InChI=1S/C12H14N6O2/c19-11(20)12(3-1-2-4-12)7-18-10(15-16-17-18)9-5-13-8-14-6-9/h5-6,8H,1-4,7H2,(H,19,20) |
| InChIKey | RUTFRYFENYINCT-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |