C14H18N4O2S — CID 115437204
1-[[5-(3-methylthiophen-2-yl)tetrazol-1-yl]methyl]cyclohexane-1-carboxylic acid (PubChem CID 115437204) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is 1-[[5-(3-methylthiophen-2-yl)tetrazol-1-yl]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[5-(3-methylthiophen-2-yl)tetrazol-1-yl]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 115437204 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-[[5-(3-methylthiophen-2-yl)tetrazol-1-yl]methyl]cyclohexane-1-carboxylic acid |
| SMILES | Cc1ccsc1-c1nnnn1CC1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C14H18N4O2S/c1-10-5-8-21-11(10)12-15-16-17-18(12)9-14(13(19)20)6-3-2-4-7-14/h5,8H,2-4,6-7,9H2,1H3,(H,19,20) |
| InChIKey | ILGLMSQIEFERHK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |