C25H25N3O3S3 — CID 20623821
4-methylsulfanyl-2-[[2-phenyl-4-[(pyridin-3-ylsulfanylcarbothioylamino)methyl]benzoyl]amino]butanoic acid (PubChem CID 20623821) has the molecular formula C25H25N3O3S3 and a molecular weight of 511.69 g/mol. Its IUPAC name is 4-methylsulfanyl-2-[[2-phenyl-4-[(pyridin-3-ylsulfanylcarbothioylamino)methyl]benzoyl]amino]butanoic acid.
| Compound Name | 4-methylsulfanyl-2-[[2-phenyl-4-[(pyridin-3-ylsulfanylcarbothioylamino)methyl]benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 20623821 |
| Molecular Formula | C25H25N3O3S3 |
| Molecular Weight | 511.69 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | 4-methylsulfanyl-2-[[2-phenyl-4-[(pyridin-3-ylsulfanylcarbothioylamino)methyl]benzoyl]amino]butanoic acid |
| SMILES | CSCCC(NC(=O)c1ccc(CNC(=S)Sc2cccnc2)cc1-c1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H25N3O3S3/c1-33-13-11-22(24(30)31)28-23(29)20-10-9-17(14-21(20)18-6-3-2-4-7-18)15-27-25(32)34-19-8-5-12-26-16-19/h2-10,12,14,16,22H,11,13,15H2,1H3,(H,27,32)(H,28,29)(H,30,31) |
| InChIKey | PURIGCMKSHMGSY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.69 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|