C24H25N3O2S2 — CID 59926878
N'-[(2R)-4-methylsulfanyl-1-oxobutan-2-yl]-2-phenyl-4-(pyridin-3-ylmethylsulfanyl)benzohydrazide (PubChem CID 59926878) has the molecular formula C24H25N3O2S2 and a molecular weight of 451.62 g/mol. Its IUPAC name is N'-[(2R)-4-methylsulfanyl-1-oxobutan-2-yl]-2-phenyl-4-(pyridin-3-ylmethylsulfanyl)benzohydrazide.
| Compound Name | N'-[(2R)-4-methylsulfanyl-1-oxobutan-2-yl]-2-phenyl-4-(pyridin-3-ylmethylsulfanyl)benzohydrazide |
|---|---|
| PubChem CID | 59926878 |
| Molecular Formula | C24H25N3O2S2 |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | N'-[(2R)-4-methylsulfanyl-1-oxobutan-2-yl]-2-phenyl-4-(pyridin-3-ylmethylsulfanyl)benzohydrazide |
| SMILES | CSCC[C@H](C=O)NNC(=O)c1ccc(SCc2cccnc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C24H25N3O2S2/c1-30-13-11-20(16-28)26-27-24(29)22-10-9-21(31-17-18-6-5-12-25-15-18)14-23(22)19-7-3-2-4-8-19/h2-10,12,14-16,20,26H,11,13,17H2,1H3,(H,27,29)/t20-/m1/s1 |
| InChIKey | JSVHFIDIOQOXBV-HXUWFJFHSA-N |
| XLogP | 4.60 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|