C24H24N2O4S — CID 23436113
2-amino-4-methylsulfanyl-2-[2-phenyl-4-(pyridin-3-ylmethoxy)benzoyl]butanoic acid (PubChem CID 23436113) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is 2-amino-4-methylsulfanyl-2-[2-phenyl-4-(pyridin-3-ylmethoxy)benzoyl]butanoic acid.
| Compound Name | 2-amino-4-methylsulfanyl-2-[2-phenyl-4-(pyridin-3-ylmethoxy)benzoyl]butanoic acid |
|---|---|
| PubChem CID | 23436113 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 2-amino-4-methylsulfanyl-2-[2-phenyl-4-(pyridin-3-ylmethoxy)benzoyl]butanoic acid |
| SMILES | CSCCC(N)(C(=O)O)C(=O)c1ccc(OCc2cccnc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C24H24N2O4S/c1-31-13-11-24(25,23(28)29)22(27)20-10-9-19(30-16-17-6-5-12-26-15-17)14-21(20)18-7-3-2-4-8-18/h2-10,12,14-15H,11,13,16,25H2,1H3,(H,28,29) |
| InChIKey | WBXBEHHEVWLNSD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|