C22H29N3O3S2 — CID 85067590
methyl 2-[[5-[(2-amino-3-sulfanylpropyl)amino]-2-phenylbenzoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 85067590) has the molecular formula C22H29N3O3S2 and a molecular weight of 447.63 g/mol. Its IUPAC name is methyl 2-[[5-[(2-amino-3-sulfanylpropyl)amino]-2-phenylbenzoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl 2-[[5-[(2-amino-3-sulfanylpropyl)amino]-2-phenylbenzoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 85067590 |
| Molecular Formula | C22H29N3O3S2 |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | methyl 2-[[5-[(2-amino-3-sulfanylpropyl)amino]-2-phenylbenzoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)C(CCSC)NC(=O)c1cc(NCC(N)CS)ccc1-c1ccccc1 |
| InChI | InChI=1S/C22H29N3O3S2/c1-28-22(27)20(10-11-30-2)25-21(26)19-12-17(24-13-16(23)14-29)8-9-18(19)15-6-4-3-5-7-15/h3-9,12,16,20,24,29H,10-11,13-14,23H2,1-2H3,(H,25,26) |
| InChIKey | MYKGUGLAWMOKOT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|