C23H26F3N3O4S2 — CID 87776672
(2,2,2-trifluoroacetyl) (2S)-2-[[4-[[(2R)-2-amino-3-sulfanylpropyl]amino]-2-phenylbenzoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 87776672) has the molecular formula C23H26F3N3O4S2 and a molecular weight of 529.61 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (2S)-2-[[4-[[(2R)-2-amino-3-sulfanylpropyl]amino]-2-phenylbenzoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | (2,2,2-trifluoroacetyl) (2S)-2-[[4-[[(2R)-2-amino-3-sulfanylpropyl]amino]-2-phenylbenzoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 87776672 |
| Molecular Formula | C23H26F3N3O4S2 |
| Molecular Weight | 529.61 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (2S)-2-[[4-[[(2R)-2-amino-3-sulfanylpropyl]amino]-2-phenylbenzoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NC(=O)c1ccc(NC[C@@H](N)CS)cc1-c1ccccc1)C(=O)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C23H26F3N3O4S2/c1-35-10-9-19(21(31)33-22(32)23(24,25)26)29-20(30)17-8-7-16(28-12-15(27)13-34)11-18(17)14-5-3-2-4-6-14/h2-8,11,15,19,28,34H,9-10,12-13,27H2,1H3,(H,29,30)/t15-,19+/m1/s1 |
| InChIKey | DKPNMNLDJMFNQW-BEFAXECRSA-N |
| XLogP | 3.51 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.61 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|