C20H22INO3S — CID 23436393
methyl 2-[[4-iodo-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 23436393) has the molecular formula C20H22INO3S and a molecular weight of 483.37 g/mol. Its IUPAC name is methyl 2-[[4-iodo-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl 2-[[4-iodo-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 23436393 |
| Molecular Formula | C20H22INO3S |
| Molecular Weight | 483.37 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | methyl 2-[[4-iodo-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)C(CCSC)NC(=O)c1ccc(I)cc1-c1ccccc1C |
| InChI | InChI=1S/C20H22INO3S/c1-13-6-4-5-7-15(13)17-12-14(21)8-9-16(17)19(23)22-18(10-11-26-3)20(24)25-2/h4-9,12,18H,10-11H2,1-3H3,(H,22,23) |
| InChIKey | VZGJMYJQJYWNKF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|