C35H39N3O4S — CID 20699776
methyl 2-[[4-[[4-(aminooxymethyl)-N-benzylanilino]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 20699776) has the molecular formula C35H39N3O4S and a molecular weight of 597.78 g/mol. Its IUPAC name is methyl 2-[[4-[[4-(aminooxymethyl)-N-benzylanilino]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl 2-[[4-[[4-(aminooxymethyl)-N-benzylanilino]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 20699776 |
| Molecular Formula | C35H39N3O4S |
| Molecular Weight | 597.78 g/mol |
| Exact Mass | 597.27 |
| IUPAC Name | methyl 2-[[4-[[4-(aminooxymethyl)-N-benzylanilino]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)C(CCSC)NC(=O)c1ccc(CN(Cc2ccccc2)c2ccc(CON)cc2)cc1-c1ccccc1C |
| InChI | InChI=1S/C35H39N3O4S/c1-25-9-7-8-12-30(25)32-21-28(15-18-31(32)34(39)37-33(19-20-43-3)35(40)41-2)23-38(22-26-10-5-4-6-11-26)29-16-13-27(14-17-29)24-42-36/h4-18,21,33H,19-20,22-24,36H2,1-3H3,(H,37,39) |
| InChIKey | FRJKTVVXWBAFAP-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.78 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|