C35H35N3O3S — CID 90760300
methyl (2S)-2-[[4-[(N-benzyl-4-isocyanoanilino)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 90760300) has the molecular formula C35H35N3O3S and a molecular weight of 577.75 g/mol. Its IUPAC name is methyl (2S)-2-[[4-[(N-benzyl-4-isocyanoanilino)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2S)-2-[[4-[(N-benzyl-4-isocyanoanilino)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 90760300 |
| Molecular Formula | C35H35N3O3S |
| Molecular Weight | 577.75 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | methyl (2S)-2-[[4-[(N-benzyl-4-isocyanoanilino)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | [C-]#[N+]c1ccc(N(Cc2ccccc2)Cc2ccc(C(=O)N[C@@H](CCSC)C(=O)OC)c(-c3ccccc3C)c2)cc1 |
| InChI | InChI=1S/C35H35N3O3S/c1-25-10-8-9-13-30(25)32-22-27(14-19-31(32)34(39)37-33(20-21-42-4)35(40)41-3)24-38(23-26-11-6-5-7-12-26)29-17-15-28(36-2)16-18-29/h5-19,22,33H,20-21,23-24H2,1,3-4H3,(H,37,39)/t33-/m0/s1 |
| InChIKey | CCSOXKDEXPTAJA-XIFFEERXSA-N |
| XLogP | 7.44 |
| TPSA | 63.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.75 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|