C34H31F2N3O3S — CID 20699147
2-[[4-[[N-[(2,5-difluorophenyl)methyl]-4-isocyanoanilino]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 20699147) has the molecular formula C34H31F2N3O3S and a molecular weight of 599.70 g/mol. Its IUPAC name is 2-[[4-[[N-[(2,5-difluorophenyl)methyl]-4-isocyanoanilino]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[4-[[N-[(2,5-difluorophenyl)methyl]-4-isocyanoanilino]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 20699147 |
| Molecular Formula | C34H31F2N3O3S |
| Molecular Weight | 599.70 g/mol |
| Exact Mass | 599.21 |
| IUPAC Name | 2-[[4-[[N-[(2,5-difluorophenyl)methyl]-4-isocyanoanilino]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | [C-]#[N+]c1ccc(N(Cc2ccc(C(=O)NC(CCSC)C(=O)O)c(-c3ccccc3C)c2)Cc2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C34H31F2N3O3S/c1-22-6-4-5-7-28(22)30-18-23(8-14-29(30)33(40)38-32(34(41)42)16-17-43-3)20-39(27-12-10-26(37-2)11-13-27)21-24-19-25(35)9-15-31(24)36/h4-15,18-19,32H,16-17,20-21H2,1,3H3,(H,38,40)(H,41,42) |
| InChIKey | QPJGEXBDXXUKSL-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 74.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.70 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|