C33H35N3O5S2 — CID 20699298
2-[[4-[(4-aminoperoxysulfanyl-N-benzylanilino)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 20699298) has the molecular formula C33H35N3O5S2 and a molecular weight of 617.79 g/mol. Its IUPAC name is 2-[[4-[(4-aminoperoxysulfanyl-N-benzylanilino)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[4-[(4-aminoperoxysulfanyl-N-benzylanilino)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 20699298 |
| Molecular Formula | C33H35N3O5S2 |
| Molecular Weight | 617.79 g/mol |
| Exact Mass | 617.20 |
| IUPAC Name | 2-[[4-[(4-aminoperoxysulfanyl-N-benzylanilino)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)c1ccc(CN(Cc2ccccc2)c2ccc(SOON)cc2)cc1-c1ccccc1C)C(=O)O |
| InChI | InChI=1S/C33H35N3O5S2/c1-23-8-6-7-11-28(23)30-20-25(12-17-29(30)32(37)35-31(33(38)39)18-19-42-2)22-36(21-24-9-4-3-5-10-24)26-13-15-27(16-14-26)43-41-40-34/h3-17,20,31H,18-19,21-22,34H2,1-2H3,(H,35,37)(H,38,39) |
| InChIKey | BITCUVRITYCQBX-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.79 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|