C9H11NO3 — CID 153289711
prop-2-enyl 6-oxo-2,5-dihydropyridine-1-carboxylate (PubChem CID 153289711) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is prop-2-enyl 6-oxo-2,5-dihydropyridine-1-carboxylate.
| Compound Name | prop-2-enyl 6-oxo-2,5-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 153289711 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | prop-2-enyl 6-oxo-2,5-dihydropyridine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CC=CCC1=O |
| InChI | InChI=1S/C9H11NO3/c1-2-7-13-9(12)10-6-4-3-5-8(10)11/h2-4H,1,5-7H2 |
| InChIKey | UEZDKEALMYIDDZ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|