C15H15N3O9 — CID 23322606
tris(prop-2-enyl) 2,4,6-trioxo-1,3,5-triazinane-1,3,5-tricarboxylate (PubChem CID 23322606) has the molecular formula C15H15N3O9 and a molecular weight of 381.30 g/mol. Its IUPAC name is tris(prop-2-enyl) 2,4,6-trioxo-1,3,5-triazinane-1,3,5-tricarboxylate.
| Compound Name | tris(prop-2-enyl) 2,4,6-trioxo-1,3,5-triazinane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 23322606 |
| Molecular Formula | C15H15N3O9 |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | tris(prop-2-enyl) 2,4,6-trioxo-1,3,5-triazinane-1,3,5-tricarboxylate |
| SMILES | C=CCOC(=O)n1c(=O)n(C(=O)OCC=C)c(=O)n(C(=O)OCC=C)c1=O |
| InChI | InChI=1S/C15H15N3O9/c1-4-7-25-13(22)16-10(19)17(14(23)26-8-5-2)12(21)18(11(16)20)15(24)27-9-6-3/h4-6H,1-3,7-9H2 |
| InChIKey | NITJUYIYEUPUES-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 144.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|