C10H11NO3S — CID 174346682
prop-2-enyl (6R)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate (PubChem CID 174346682) has the molecular formula C10H11NO3S and a molecular weight of 225.27 g/mol. Its IUPAC name is prop-2-enyl (6R)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate.
| Compound Name | prop-2-enyl (6R)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate |
|---|---|
| PubChem CID | 174346682 |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | prop-2-enyl (6R)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate |
| SMILES | C=CCOC(=O)C1C=CN2C(=O)C[C@H]2S1 |
| InChI | InChI=1S/C10H11NO3S/c1-2-5-14-10(13)7-3-4-11-8(12)6-9(11)15-7/h2-4,7,9H,1,5-6H2/t7?,9-/m1/s1 |
| InChIKey | IJYQACISEHMGHP-NHSZFOGYSA-N |
| XLogP | 0.90 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|