C20H17NO3S — CID 174345017
benzhydryl (6R)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate (PubChem CID 174345017) has the molecular formula C20H17NO3S and a molecular weight of 351.43 g/mol. Its IUPAC name is benzhydryl (6R)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate.
| Compound Name | benzhydryl (6R)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate |
|---|---|
| PubChem CID | 174345017 |
| Molecular Formula | C20H17NO3S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | benzhydryl (6R)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate |
| SMILES | O=C(OC(c1ccccc1)c1ccccc1)C1C=CN2C(=O)C[C@H]2S1 |
| InChI | InChI=1S/C20H17NO3S/c22-17-13-18-21(17)12-11-16(25-18)20(23)24-19(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-12,16,18-19H,13H2/t16?,18-/m1/s1 |
| InChIKey | PYEVGNNGVPGDSZ-UHUGOGIASA-N |
| XLogP | 3.51 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |