C23H20N2O3S — CID 57245417
benzhydryl (2S,3S,5R)-3-(2-cyanoethenyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 57245417) has the molecular formula C23H20N2O3S and a molecular weight of 404.49 g/mol. Its IUPAC name is benzhydryl (2S,3S,5R)-3-(2-cyanoethenyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzhydryl (2S,3S,5R)-3-(2-cyanoethenyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 57245417 |
| Molecular Formula | C23H20N2O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | benzhydryl (2S,3S,5R)-3-(2-cyanoethenyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[C@@]1(C=CC#N)S[C@@H]2CC(=O)N2[C@H]1C(=O)OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20N2O3S/c1-23(13-8-14-24)21(25-18(26)15-19(25)29-23)22(27)28-20(16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2-13,19-21H,15H2,1H3/t19-,21+,23+/m1/s1 |
| InChIKey | SQDTYTNYTRMIAM-NWSQWKLXSA-N |
| XLogP | 3.83 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|