benzhydryl (3S)-5-oxo-1-phenylpyrrolidine-3-carboxylate

C24H21NO3 — CID 27153708

IUPACbenzhydryl (3S)-5-oxo-1-phenylpyrrolidine-3-carboxylate
SMILESO=C(OC(c1ccccc1)c1ccccc1)[C@H]1CC(=O)N(c2ccccc2)C1
InChIInChI=1S/C24H21NO3/c26-22-16-20(17-25(22)21-14-8-3-9-15-21)24(27)28-23(18-10-4-1-5-11-18)19-12-6-2-7-13-19/h1-15,20,23H,16-17H2/t20-/m0/s1
InChIKeyHQLGKXQVIAUCIS-FQEVSTJZSA-N
MW371.44 g/mol
LogP4.37
Rot. Bonds5

About benzhydryl (3S)-5-oxo-1-phenylpyrrolidine-3-carboxylate

benzhydryl (3S)-5-oxo-1-phenylpyrrolidine-3-carboxylate (PubChem CID 27153708) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is benzhydryl (3S)-5-oxo-1-phenylpyrrolidine-3-carboxylate.

Molecular Properties

Compound Namebenzhydryl (3S)-5-oxo-1-phenylpyrrolidine-3-carboxylate
PubChem CID27153708
Molecular FormulaC24H21NO3
Molecular Weight371.44 g/mol
Exact Mass371.15
IUPAC Namebenzhydryl (3S)-5-oxo-1-phenylpyrrolidine-3-carboxylate
SMILESO=C(OC(c1ccccc1)c1ccccc1)[C@H]1CC(=O)N(c2ccccc2)C1
InChIInChI=1S/C24H21NO3/c26-22-16-20(17-25(22)21-14-8-3-9-15-21)24(27)28-23(18-10-4-1-5-11-18)19-12-6-2-7-13-19/h1-15,20,23H,16-17H2/t20-/m0/s1
InChIKeyHQLGKXQVIAUCIS-FQEVSTJZSA-N
XLogP4.37
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms28
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500371.44
LogP ≤ 54.37
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze benzhydryl (3S)-5-oxo-1-phenylpyrrolidine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzhydryl (3S)-5-oxo-1-phenylpyrrolidine-3-carboxylate?
The IUPAC name of benzhydryl (3S)-5-oxo-1-phenylpyrrolidine-3-carboxylate (CID 27153708) is benzhydryl (3S)-5-oxo-1-phenylpyrrolidine-3-carboxylate.
What is the SMILES notation for benzhydryl (3S)-5-oxo-1-phenylpyrrolidine-3-carboxylate?
The canonical SMILES for benzhydryl (3S)-5-oxo-1-phenylpyrrolidine-3-carboxylate is O=C(OC(c1ccccc1)c1ccccc1)[C@H]1CC(=O)N(c2ccccc2)C1.
What is the InChIKey of benzhydryl (3S)-5-oxo-1-phenylpyrrolidine-3-carboxylate?
The InChIKey is HQLGKXQVIAUCIS-FQEVSTJZSA-N. The full InChI is InChI=1S/C24H21NO3/c26-22-16-20(17-25(22)21-14-8-3-9-15-21)24(27)28-23(18-10-4-1-5-11-18)19-12-6-2-7-13-19/h1-15,20,23H,16-17H2/t20-/m0/s1.
What are the key properties of benzhydryl (3S)-5-oxo-1-phenylpyrrolidine-3-carboxylate?
benzhydryl (3S)-5-oxo-1-phenylpyrrolidine-3-carboxylate has a molecular weight of 371.44 g/mol, XLogP of 4.37, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzhydryl (3S)-5-oxo-1-phenylpyrrolidine-3-carboxylate is sourced from PubChem (CID 27153708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).