C21H17NO4S — CID 14525270
benzhydryl 3-formyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 14525270) has the molecular formula C21H17NO4S and a molecular weight of 379.44 g/mol. Its IUPAC name is benzhydryl 3-formyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl 3-formyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 14525270 |
| Molecular Formula | C21H17NO4S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | benzhydryl 3-formyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | O=CC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)CC2SC1 |
| InChI | InChI=1S/C21H17NO4S/c23-12-16-13-27-18-11-17(24)22(18)19(16)21(25)26-20(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,12,18,20H,11,13H2 |
| InChIKey | FUWQEBBYQHOKRU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|