C58H45NO3S — CID 174274284
benzhydryl (6R)-8-oxo-4,4-ditrityl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 174274284) has the molecular formula C58H45NO3S and a molecular weight of 836.07 g/mol. Its IUPAC name is benzhydryl (6R)-8-oxo-4,4-ditrityl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R)-8-oxo-4,4-ditrityl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 174274284 |
| Molecular Formula | C58H45NO3S |
| Molecular Weight | 836.07 g/mol |
| Exact Mass | 835.31 |
| IUPAC Name | benzhydryl (6R)-8-oxo-4,4-ditrityl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | O=C(OC(c1ccccc1)c1ccccc1)C1=CC(C(c2ccccc2)(c2ccccc2)c2ccccc2)(C(c2ccccc2)(c2ccccc2)c2ccccc2)S[C@@H]2CC(=O)N12 |
| InChI | InChI=1S/C58H45NO3S/c60-52-41-53-59(52)51(55(61)62-54(43-25-9-1-10-26-43)44-27-11-2-12-28-44)42-56(63-53,57(45-29-13-3-14-30-45,46-31-15-4-16-32-46)47-33-17-5-18-34-47)58(48-35-19-6-20-36-48,49-37-21-7-22-38-49)50-39-23-8-24-40-50/h1-40,42,53-54H,41H2/t53-/m1/s1 |
| InChIKey | VZWIXCUFOQPCFY-IONAWPRUSA-N |
| XLogP | 12.32 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.07 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|