C21H18BrNO5S — CID 22848775
benzhydryl (6S)-3-(bromomethyl)-5,5,8-trioxo-5λ6-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 22848775) has the molecular formula C21H18BrNO5S and a molecular weight of 476.35 g/mol. Its IUPAC name is benzhydryl (6S)-3-(bromomethyl)-5,5,8-trioxo-5λ6-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6S)-3-(bromomethyl)-5,5,8-trioxo-5λ6-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 22848775 |
| Molecular Formula | C21H18BrNO5S |
| Molecular Weight | 476.35 g/mol |
| Exact Mass | 475.01 |
| IUPAC Name | benzhydryl (6S)-3-(bromomethyl)-5,5,8-trioxo-5λ6-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | O=C(OC(c1ccccc1)c1ccccc1)C1=C(CBr)CS(=O)(=O)[C@H]2CC(=O)N12 |
| InChI | InChI=1S/C21H18BrNO5S/c22-12-16-13-29(26,27)18-11-17(24)23(18)19(16)21(25)28-20(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,18,20H,11-13H2/t18-/m0/s1 |
| InChIKey | TVPYWBMRKMZSGN-SFHVURJKSA-N |
| XLogP | 2.95 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|