C21H17NO5S2 — CID 151408563
(2,2-diphenylacetyl)oxymethyl (6R)-8-oxo-4,5-dithia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 151408563) has the molecular formula C21H17NO5S2 and a molecular weight of 427.50 g/mol. Its IUPAC name is (2,2-diphenylacetyl)oxymethyl (6R)-8-oxo-4,5-dithia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (2,2-diphenylacetyl)oxymethyl (6R)-8-oxo-4,5-dithia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 151408563 |
| Molecular Formula | C21H17NO5S2 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | (2,2-diphenylacetyl)oxymethyl (6R)-8-oxo-4,5-dithia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | O=C(OCOC(=O)C(c1ccccc1)c1ccccc1)C1=CSS[C@@H]2CC(=O)N12 |
| InChI | InChI=1S/C21H17NO5S2/c23-17-11-18-22(17)16(12-28-29-18)20(24)26-13-27-21(25)19(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,12,18-19H,11,13H2/t18-/m1/s1 |
| InChIKey | OYAAMJHMNOSWPB-GOSISDBHSA-N |
| XLogP | 3.66 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|