About oxan-2-ylmethyl (5R)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate
oxan-2-ylmethyl (5R)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 150039459) has the molecular formula C12H15NO4S
and a molecular weight of 269.32 g/mol. Its IUPAC name is oxan-2-ylmethyl (5R)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
Molecular Properties
| Compound Name | oxan-2-ylmethyl (5R)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| PubChem CID | 150039459 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | oxan-2-ylmethyl (5R)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | O=C(OCC1CCCCO1)C1=CS[C@@H]2CC(=O)N12 |
| InChI | InChI=1S/C12H15NO4S/c14-10-5-11-13(10)9(7-18-11)12(15)17-6-8-3-1-2-4-16-8/h7-8,11H,1-6H2/t8?,11-/m1/s1 |
| InChIKey | DIZAUQSKFXHEDN-QHDYGNBISA-N |
| XLogP | 1.25 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze oxan-2-ylmethyl (5R)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-2-ylmethyl (5R)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate?
The IUPAC name of oxan-2-ylmethyl (5R)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (CID 150039459) is oxan-2-ylmethyl (5R)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
What is the SMILES notation for oxan-2-ylmethyl (5R)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate?
The canonical SMILES for oxan-2-ylmethyl (5R)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate is O=C(OCC1CCCCO1)C1=CS[C@@H]2CC(=O)N12.
What is the InChIKey of oxan-2-ylmethyl (5R)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate?
The InChIKey is DIZAUQSKFXHEDN-QHDYGNBISA-N. The full InChI is InChI=1S/C12H15NO4S/c14-10-5-11-13(10)9(7-18-11)12(15)17-6-8-3-1-2-4-16-8/h7-8,11H,1-6H2/t8?,11-/m1/s1.
What are the key properties of oxan-2-ylmethyl (5R)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate?
oxan-2-ylmethyl (5R)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate has a molecular weight of 269.32 g/mol, XLogP of 1.25, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-2-ylmethyl (5R)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate is sourced from PubChem (CID 150039459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).