C9H12N2O3S2 — CID 154414607
2-aminoethylsulfanylmethyl (5R)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 154414607) has the molecular formula C9H12N2O3S2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-aminoethylsulfanylmethyl (5R)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | 2-aminoethylsulfanylmethyl (5R)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 154414607 |
| Molecular Formula | C9H12N2O3S2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 2-aminoethylsulfanylmethyl (5R)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | NCCSCOC(=O)C1=CS[C@@H]2CC(=O)N12 |
| InChI | InChI=1S/C9H12N2O3S2/c10-1-2-15-5-14-9(13)6-4-16-8-3-7(12)11(6)8/h4,8H,1-3,5,10H2/t8-/m1/s1 |
| InChIKey | SZKXIXPBUJKSLR-MRVPVSSYSA-N |
| XLogP | 0.33 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|