C19H26N3O3S2+ — CID 67743587
[1-(hexylamino)pyridin-1-ium-4-yl]sulfanylmethyl (6S)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 67743587) has the molecular formula C19H26N3O3S2+ and a molecular weight of 408.57 g/mol. Its IUPAC name is [1-(hexylamino)pyridin-1-ium-4-yl]sulfanylmethyl (6S)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | [1-(hexylamino)pyridin-1-ium-4-yl]sulfanylmethyl (6S)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 67743587 |
| Molecular Formula | C19H26N3O3S2+ |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | [1-(hexylamino)pyridin-1-ium-4-yl]sulfanylmethyl (6S)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCCCCCN[n+]1ccc(SCOC(=O)C2=CCS[C@H]3CC(=O)N23)cc1 |
| InChI | InChI=1S/C19H26N3O3S2/c1-2-3-4-5-9-20-21-10-6-15(7-11-21)27-14-25-19(24)16-8-12-26-18-13-17(23)22(16)18/h6-8,10-11,18,20H,2-5,9,12-14H2,1H3/q+1/t18-/m0/s1 |
| InChIKey | ROOSODHZVNGEHU-SFHVURJKSA-N |
| XLogP | 2.88 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|