C11H14KNO3S — CID 70530826
potassium (5S)-7-oxo-3-pentyl-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 70530826) has the molecular formula C11H14KNO3S and a molecular weight of 279.40 g/mol. Its IUPAC name is potassium (5S)-7-oxo-3-pentyl-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | potassium (5S)-7-oxo-3-pentyl-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70530826 |
| Molecular Formula | C11H14KNO3S |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | potassium (5S)-7-oxo-3-pentyl-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CCCCCC1=C(C(=O)[O-])N2C(=O)C[C@@H]2S1.[K+] |
| InChI | InChI=1S/C11H15NO3S.K/c1-2-3-4-5-7-10(11(14)15)12-8(13)6-9(12)16-7;/h9H,2-6H2,1H3,(H,14,15);/q;+1/p-1/t9-;/m0./s1 |
| InChIKey | OFYFBISOALTZNL-FVGYRXGTSA-M |
| XLogP | -2.16 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|