C7H7NO3S2 — CID 57045086
(5R)-3-methylsulfanyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 57045086) has the molecular formula C7H7NO3S2 and a molecular weight of 217.27 g/mol. Its IUPAC name is (5R)-3-methylsulfanyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R)-3-methylsulfanyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 57045086 |
| Molecular Formula | C7H7NO3S2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 216.99 |
| IUPAC Name | (5R)-3-methylsulfanyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | CSC1=C(C(=O)O)N2C(=O)C[C@H]2S1 |
| InChI | InChI=1S/C7H7NO3S2/c1-12-7-5(6(10)11)8-3(9)2-4(8)13-7/h4H,2H2,1H3,(H,10,11)/t4-/m1/s1 |
| InChIKey | PWCIKRXEIZRLGE-SCSAIBSYSA-N |
| XLogP | 0.91 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |