C7H7NO4S — CID 77380454
3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 77380454) has the molecular formula C7H7NO4S and a molecular weight of 201.20 g/mol. Its IUPAC name is 3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | 3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 77380454 |
| Molecular Formula | C7H7NO4S |
| Molecular Weight | 201.20 g/mol |
| Exact Mass | 201.01 |
| IUPAC Name | 3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | O=C(O)C1=C(O)CSC2CC(=O)N12 |
| InChI | InChI=1S/C7H7NO4S/c9-3-2-13-5-1-4(10)8(5)6(3)7(11)12/h5,9H,1-2H2,(H,11,12) |
| InChIKey | YTCUEIOOUOMPAT-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.20 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |