C7H6ClNO3S — CID 22790783
(6S)-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 22790783) has the molecular formula C7H6ClNO3S and a molecular weight of 219.65 g/mol. Its IUPAC name is (6S)-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 22790783 |
| Molecular Formula | C7H6ClNO3S |
| Molecular Weight | 219.65 g/mol |
| Exact Mass | 218.98 |
| IUPAC Name | (6S)-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | O=C(O)C1=C(Cl)CS[C@H]2CC(=O)N12 |
| InChI | InChI=1S/C7H6ClNO3S/c8-3-2-13-5-1-4(10)9(5)6(3)7(11)12/h5H,1-2H2,(H,11,12)/t5-/m0/s1 |
| InChIKey | MDTNTKLGRUURFT-YFKPBYRVSA-N |
| XLogP | 0.83 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.65 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |