About 3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;trihydrate
3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;trihydrate (PubChem CID 141441596) has the molecular formula C9H15NO6S
and a molecular weight of 265.29 g/mol. Its IUPAC name is 3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;trihydrate.
Molecular Properties
| Compound Name | 3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;trihydrate |
| PubChem CID | 141441596 |
| Molecular Formula | C9H15NO6S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;trihydrate |
| SMILES | C=CC1=C(C(=O)O)N2C(=O)CC2SC1.O.O.O |
| InChI | InChI=1S/C9H9NO3S.3H2O/c1-2-5-4-14-7-3-6(11)10(7)8(5)9(12)13;;;/h2,7H,1,3-4H2,(H,12,13);3*1H2 |
| InChIKey | CDINEEXGKNETCF-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 152.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;trihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;trihydrate?
The IUPAC name of 3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;trihydrate (CID 141441596) is 3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;trihydrate.
What is the SMILES notation for 3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;trihydrate?
The canonical SMILES for 3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;trihydrate is C=CC1=C(C(=O)O)N2C(=O)CC2SC1.O.O.O.
What is the InChIKey of 3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;trihydrate?
The InChIKey is CDINEEXGKNETCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3S.3H2O/c1-2-5-4-14-7-3-6(11)10(7)8(5)9(12)13;;;/h2,7H,1,3-4H2,(H,12,13);3*1H2.
What are the key properties of 3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;trihydrate?
3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;trihydrate has a molecular weight of 265.29 g/mol, XLogP of -1.66, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;trihydrate is sourced from PubChem (CID 141441596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).