C6H8NO4PS — CID 21323920
(8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-2-yl)phosphonic acid (PubChem CID 21323920) has the molecular formula C6H8NO4PS and a molecular weight of 221.17 g/mol. Its IUPAC name is (8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-2-yl)phosphonic acid.
| Compound Name | (8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-2-yl)phosphonic acid |
|---|---|
| PubChem CID | 21323920 |
| Molecular Formula | C6H8NO4PS |
| Molecular Weight | 221.17 g/mol |
| Exact Mass | 220.99 |
| IUPAC Name | (8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-2-yl)phosphonic acid |
| SMILES | O=C1CC2SCC=C(P(=O)(O)O)N12 |
| InChI | InChI=1S/C6H8NO4PS/c8-4-3-6-7(4)5(1-2-13-6)12(9,10)11/h1,6H,2-3H2,(H2,9,10,11) |
| InChIKey | ARFKQMHPTUCVLP-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.17 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|