C7H8NNaO3S — CID 173457866
sodium;hydride;(6R)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 173457866) has the molecular formula C7H8NNaO3S and a molecular weight of 209.20 g/mol. Its IUPAC name is sodium;hydride;(6R)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | sodium;hydride;(6R)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 173457866 |
| Molecular Formula | C7H8NNaO3S |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.01 |
| IUPAC Name | sodium;hydride;(6R)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | O=C(O)C1=CCS[C@@H]2CC(=O)N12.[H-].[Na+] |
| InChI | InChI=1S/C7H7NO3S.Na.H/c9-5-3-6-8(5)4(7(10)11)1-2-12-6;;/h1,6H,2-3H2,(H,10,11);;/q;+1;-1/t6-;;/m1../s1 |
| InChIKey | BEAKMSNIOTXCNJ-QYCVXMPOSA-N |
| XLogP | -2.62 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |