C8H12NO7PS — CID 172819810
(6R)-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;phosphoric acid (PubChem CID 172819810) has the molecular formula C8H12NO7PS and a molecular weight of 297.23 g/mol. Its IUPAC name is (6R)-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;phosphoric acid.
| Compound Name | (6R)-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;phosphoric acid |
|---|---|
| PubChem CID | 172819810 |
| Molecular Formula | C8H12NO7PS |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | (6R)-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;phosphoric acid |
| SMILES | CC1C=C(C(=O)O)N2C(=O)C[C@H]2S1.O=P(O)(O)O |
| InChI | InChI=1S/C8H9NO3S.H3O4P/c1-4-2-5(8(11)12)9-6(10)3-7(9)13-4;1-5(2,3)4/h2,4,7H,3H2,1H3,(H,11,12);(H3,1,2,3,4)/t4?,7-;/m1./s1 |
| InChIKey | UBLMSOZGPXLDJA-GUNDQUCTSA-N |
| XLogP | -0.28 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|