C7H8INO3S — CID 131713478
(6R)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;hydroiodide (PubChem CID 131713478) has the molecular formula C7H8INO3S and a molecular weight of 313.12 g/mol. Its IUPAC name is (6R)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;hydroiodide.
| Compound Name | (6R)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;hydroiodide |
|---|---|
| PubChem CID | 131713478 |
| Molecular Formula | C7H8INO3S |
| Molecular Weight | 313.12 g/mol |
| Exact Mass | 312.93 |
| IUPAC Name | (6R)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;hydroiodide |
| SMILES | I.O=C(O)C1=CCS[C@@H]2CC(=O)N12 |
| InChI | InChI=1S/C7H7NO3S.HI/c9-5-3-6-8(5)4(7(10)11)1-2-12-6;/h1,6H,2-3H2,(H,10,11);1H/t6-;/m1./s1 |
| InChIKey | LDLOMUGNOOIFNO-FYZOBXCZSA-N |
| XLogP | 0.88 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.12 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|