C16H20N2O5S — CID 3709333
prop-2-enyl 2-[2-(4-methylsulfonylphenyl)acetyl]pyrazolidine-1-carboxylate (PubChem CID 3709333) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is prop-2-enyl 2-[2-(4-methylsulfonylphenyl)acetyl]pyrazolidine-1-carboxylate.
| Compound Name | prop-2-enyl 2-[2-(4-methylsulfonylphenyl)acetyl]pyrazolidine-1-carboxylate |
|---|---|
| PubChem CID | 3709333 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | prop-2-enyl 2-[2-(4-methylsulfonylphenyl)acetyl]pyrazolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCCN1C(=O)Cc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H20N2O5S/c1-3-11-23-16(20)18-10-4-9-17(18)15(19)12-13-5-7-14(8-6-13)24(2,21)22/h3,5-8H,1,4,9-12H2,2H3 |
| InChIKey | OKNWBUPEZKANQK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|