C18H18ClN3O4S — CID 3845276
1-[2-(6-chloropyridine-3-carbonyl)pyrazolidin-1-yl]-2-(4-methylsulfonylphenyl)ethanone (PubChem CID 3845276) has the molecular formula C18H18ClN3O4S and a molecular weight of 407.88 g/mol. Its IUPAC name is 1-[2-(6-chloropyridine-3-carbonyl)pyrazolidin-1-yl]-2-(4-methylsulfonylphenyl)ethanone.
| Compound Name | 1-[2-(6-chloropyridine-3-carbonyl)pyrazolidin-1-yl]-2-(4-methylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 3845276 |
| Molecular Formula | C18H18ClN3O4S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 1-[2-(6-chloropyridine-3-carbonyl)pyrazolidin-1-yl]-2-(4-methylsulfonylphenyl)ethanone |
| SMILES | CS(=O)(=O)c1ccc(CC(=O)N2CCCN2C(=O)c2ccc(Cl)nc2)cc1 |
| InChI | InChI=1S/C18H18ClN3O4S/c1-27(25,26)15-6-3-13(4-7-15)11-17(23)21-9-2-10-22(21)18(24)14-5-8-16(19)20-12-14/h3-8,12H,2,9-11H2,1H3 |
| InChIKey | USRZCAAGGZXBBH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|