C14H14ClN3O3S — CID 2446892
6-chloro-N-[2-(4-sulfamoylphenyl)ethyl]pyridine-3-carboxamide (PubChem CID 2446892) has the molecular formula C14H14ClN3O3S and a molecular weight of 339.80 g/mol. Its IUPAC name is 6-chloro-N-[2-(4-sulfamoylphenyl)ethyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[2-(4-sulfamoylphenyl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 2446892 |
| Molecular Formula | C14H14ClN3O3S |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 6-chloro-N-[2-(4-sulfamoylphenyl)ethyl]pyridine-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)c2ccc(Cl)nc2)cc1 |
| InChI | InChI=1S/C14H14ClN3O3S/c15-13-6-3-11(9-18-13)14(19)17-8-7-10-1-4-12(5-2-10)22(16,20)21/h1-6,9H,7-8H2,(H,17,19)(H2,16,20,21) |
| InChIKey | MTDJMTUPCCKAAY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|