C15H17N3O3S — CID 44520905
2-pyridin-4-yl-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 44520905) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is 2-pyridin-4-yl-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-pyridin-4-yl-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 44520905 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2-pyridin-4-yl-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)Cc2ccncc2)cc1 |
| InChI | InChI=1S/C15H17N3O3S/c16-22(20,21)14-3-1-12(2-4-14)7-10-18-15(19)11-13-5-8-17-9-6-13/h1-6,8-9H,7,10-11H2,(H,18,19)(H2,16,20,21) |
| InChIKey | DWBDLRRSMVHYTQ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |