C27H31N3O3S — CID 155537916
(E)-N-[6-[3-[(2-methylphenyl)sulfamoyl]phenyl]hexyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 155537916) has the molecular formula C27H31N3O3S and a molecular weight of 477.63 g/mol. Its IUPAC name is (E)-N-[6-[3-[(2-methylphenyl)sulfamoyl]phenyl]hexyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[6-[3-[(2-methylphenyl)sulfamoyl]phenyl]hexyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 155537916 |
| Molecular Formula | C27H31N3O3S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | (E)-N-[6-[3-[(2-methylphenyl)sulfamoyl]phenyl]hexyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | Cc1ccccc1NS(=O)(=O)c1cccc(CCCCCCNC(=O)/C=C/c2cccnc2)c1 |
| InChI | InChI=1S/C27H31N3O3S/c1-22-10-5-6-15-26(22)30-34(32,33)25-14-8-12-23(20-25)11-4-2-3-7-19-29-27(31)17-16-24-13-9-18-28-21-24/h5-6,8-10,12-18,20-21,30H,2-4,7,11,19H2,1H3,(H,29,31)/b17-16+ |
| InChIKey | IMZSPKOXCNAVIW-WUKNDPDISA-N |
| XLogP | 5.12 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|