C22H26N2O6S3 — CID 3783265
1-[2-[2-[2-(benzenesulfonyl)ethylsulfanyl]acetyl]pyrazolidin-1-yl]-2-(4-methylsulfonylphenyl)ethanone (PubChem CID 3783265) has the molecular formula C22H26N2O6S3 and a molecular weight of 510.66 g/mol. Its IUPAC name is 1-[2-[2-[2-(benzenesulfonyl)ethylsulfanyl]acetyl]pyrazolidin-1-yl]-2-(4-methylsulfonylphenyl)ethanone.
| Compound Name | 1-[2-[2-[2-(benzenesulfonyl)ethylsulfanyl]acetyl]pyrazolidin-1-yl]-2-(4-methylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 3783265 |
| Molecular Formula | C22H26N2O6S3 |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | 1-[2-[2-[2-(benzenesulfonyl)ethylsulfanyl]acetyl]pyrazolidin-1-yl]-2-(4-methylsulfonylphenyl)ethanone |
| SMILES | CS(=O)(=O)c1ccc(CC(=O)N2CCCN2C(=O)CSCCS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H26N2O6S3/c1-32(27,28)19-10-8-18(9-11-19)16-21(25)23-12-5-13-24(23)22(26)17-31-14-15-33(29,30)20-6-3-2-4-7-20/h2-4,6-11H,5,12-17H2,1H3 |
| InChIKey | DFJBFTGWDZYHKL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|