C20H30N4O4S2 — CID 74224103
2-[2-(4-methylsulfonylphenyl)acetyl]-N-(3-morpholin-4-ylpropyl)pyrazolidine-1-carbothioamide (PubChem CID 74224103) has the molecular formula C20H30N4O4S2 and a molecular weight of 454.62 g/mol. Its IUPAC name is 2-[2-(4-methylsulfonylphenyl)acetyl]-N-(3-morpholin-4-ylpropyl)pyrazolidine-1-carbothioamide.
| Compound Name | 2-[2-(4-methylsulfonylphenyl)acetyl]-N-(3-morpholin-4-ylpropyl)pyrazolidine-1-carbothioamide |
|---|---|
| PubChem CID | 74224103 |
| Molecular Formula | C20H30N4O4S2 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 2-[2-(4-methylsulfonylphenyl)acetyl]-N-(3-morpholin-4-ylpropyl)pyrazolidine-1-carbothioamide |
| SMILES | CS(=O)(=O)c1ccc(CC(=O)N2CCCN2C(=S)NCCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C20H30N4O4S2/c1-30(26,27)18-6-4-17(5-7-18)16-19(25)23-10-3-11-24(23)20(29)21-8-2-9-22-12-14-28-15-13-22/h4-7H,2-3,8-16H2,1H3,(H,21,29) |
| InChIKey | XBYMIJRHGJZUKI-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|