C19H26N4O4S — CID 3549777
2-[2-(1,3-benzodioxol-5-yl)acetyl]-N-(2-morpholin-4-ylethyl)pyrazolidine-1-carbothioamide (PubChem CID 3549777) has the molecular formula C19H26N4O4S and a molecular weight of 406.51 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)acetyl]-N-(2-morpholin-4-ylethyl)pyrazolidine-1-carbothioamide.
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)acetyl]-N-(2-morpholin-4-ylethyl)pyrazolidine-1-carbothioamide |
|---|---|
| PubChem CID | 3549777 |
| Molecular Formula | C19H26N4O4S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)acetyl]-N-(2-morpholin-4-ylethyl)pyrazolidine-1-carbothioamide |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)N1CCCN1C(=S)NCCN1CCOCC1 |
| InChI | InChI=1S/C19H26N4O4S/c24-18(13-15-2-3-16-17(12-15)27-14-26-16)22-5-1-6-23(22)19(28)20-4-7-21-8-10-25-11-9-21/h2-3,12H,1,4-11,13-14H2,(H,20,28) |
| InChIKey | HTMUVSBTIASODH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 66.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|