C16H19N3O3S — CID 3852196
2-[2-(1,3-benzodioxol-5-yl)acetyl]-N-cyclopropylpyrazolidine-1-carbothioamide (PubChem CID 3852196) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)acetyl]-N-cyclopropylpyrazolidine-1-carbothioamide.
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)acetyl]-N-cyclopropylpyrazolidine-1-carbothioamide |
|---|---|
| PubChem CID | 3852196 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)acetyl]-N-cyclopropylpyrazolidine-1-carbothioamide |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)N1CCCN1C(=S)NC1CC1 |
| InChI | InChI=1S/C16H19N3O3S/c20-15(9-11-2-5-13-14(8-11)22-10-21-13)18-6-1-7-19(18)16(23)17-12-3-4-12/h2,5,8,12H,1,3-4,6-7,9-10H2,(H,17,23) |
| InChIKey | ROOAXGAAXOAKKM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|