C17H24N2O3 — CID 86822757
2-(1,3-benzodioxol-5-yl)-N-(1-propylpiperidin-4-yl)acetamide (PubChem CID 86822757) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-(1-propylpiperidin-4-yl)acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-(1-propylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 86822757 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-(1-propylpiperidin-4-yl)acetamide |
| SMILES | CCCN1CCC(NC(=O)Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C17H24N2O3/c1-2-7-19-8-5-14(6-9-19)18-17(20)11-13-3-4-15-16(10-13)22-12-21-15/h3-4,10,14H,2,5-9,11-12H2,1H3,(H,18,20) |
| InChIKey | QJGJFCRPDKZRII-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |