C17H22N2O3 — CID 16668006
2-[4-(1,3-benzodioxol-5-yl)piperidin-1-yl]-N-cyclopropylacetamide (PubChem CID 16668006) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-yl)piperidin-1-yl]-N-cyclopropylacetamide.
| Compound Name | 2-[4-(1,3-benzodioxol-5-yl)piperidin-1-yl]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 16668006 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-yl)piperidin-1-yl]-N-cyclopropylacetamide |
| SMILES | O=C(CN1CCC(c2ccc3c(c2)OCO3)CC1)NC1CC1 |
| InChI | InChI=1S/C17H22N2O3/c20-17(18-14-2-3-14)10-19-7-5-12(6-8-19)13-1-4-15-16(9-13)22-11-21-15/h1,4,9,12,14H,2-3,5-8,10-11H2,(H,18,20) |
| InChIKey | DHQRLTYKYQZPDW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |