C12H14O3 — CID 164806330
(4-ethyl-2-hydroxyphenyl)methyl prop-2-enoate (PubChem CID 164806330) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (4-ethyl-2-hydroxyphenyl)methyl prop-2-enoate.
| Compound Name | (4-ethyl-2-hydroxyphenyl)methyl prop-2-enoate |
|---|---|
| PubChem CID | 164806330 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (4-ethyl-2-hydroxyphenyl)methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1ccc(CC)cc1O |
| InChI | InChI=1S/C12H14O3/c1-3-9-5-6-10(11(13)7-9)8-15-12(14)4-2/h4-7,13H,2-3,8H2,1H3 |
| InChIKey | VVUBCQFOWRMRPQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|