C22H24O5 — CID 134193091
[4-(2-hydroxyethyl)-3-(prop-2-enoyloxymethyl)phenyl] 4-propylbenzoate (PubChem CID 134193091) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is [4-(2-hydroxyethyl)-3-(prop-2-enoyloxymethyl)phenyl] 4-propylbenzoate.
| Compound Name | [4-(2-hydroxyethyl)-3-(prop-2-enoyloxymethyl)phenyl] 4-propylbenzoate |
|---|---|
| PubChem CID | 134193091 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | [4-(2-hydroxyethyl)-3-(prop-2-enoyloxymethyl)phenyl] 4-propylbenzoate |
| SMILES | C=CC(=O)OCc1cc(OC(=O)c2ccc(CCC)cc2)ccc1CCO |
| InChI | InChI=1S/C22H24O5/c1-3-5-16-6-8-18(9-7-16)22(25)27-20-11-10-17(12-13-23)19(14-20)15-26-21(24)4-2/h4,6-11,14,23H,2-3,5,12-13,15H2,1H3 |
| InChIKey | BFPOPHXJXGSMIQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|