C19H12F4O4 — CID 146531862
[4-(2,3-difluoro-4-prop-2-enoyloxyphenyl)-2,3-difluorophenyl]methyl prop-2-enoate (PubChem CID 146531862) has the molecular formula C19H12F4O4 and a molecular weight of 380.29 g/mol. Its IUPAC name is [4-(2,3-difluoro-4-prop-2-enoyloxyphenyl)-2,3-difluorophenyl]methyl prop-2-enoate.
| Compound Name | [4-(2,3-difluoro-4-prop-2-enoyloxyphenyl)-2,3-difluorophenyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 146531862 |
| Molecular Formula | C19H12F4O4 |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | [4-(2,3-difluoro-4-prop-2-enoyloxyphenyl)-2,3-difluorophenyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1ccc(-c2ccc(OC(=O)C=C)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C19H12F4O4/c1-3-14(24)26-9-10-5-6-11(17(21)16(10)20)12-7-8-13(19(23)18(12)22)27-15(25)4-2/h3-8H,1-2,9H2 |
| InChIKey | KJVCTZVJBRUONB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|