C37H30O9 — CID 118605836
[4-methyl-3-prop-2-enoyloxy-2-[(E)-3-(4-prop-2-enoyloxyphenoxy)prop-1-enyl]-5-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]methyl prop-2-enoate (PubChem CID 118605836) has the molecular formula C37H30O9 and a molecular weight of 618.64 g/mol. Its IUPAC name is [4-methyl-3-prop-2-enoyloxy-2-[(E)-3-(4-prop-2-enoyloxyphenoxy)prop-1-enyl]-5-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]methyl prop-2-enoate.
| Compound Name | [4-methyl-3-prop-2-enoyloxy-2-[(E)-3-(4-prop-2-enoyloxyphenoxy)prop-1-enyl]-5-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 118605836 |
| Molecular Formula | C37H30O9 |
| Molecular Weight | 618.64 g/mol |
| Exact Mass | 618.19 |
| IUPAC Name | [4-methyl-3-prop-2-enoyloxy-2-[(E)-3-(4-prop-2-enoyloxyphenoxy)prop-1-enyl]-5-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1cc(C#Cc2ccc(OC(=O)C=C)cc2)c(C)c(OC(=O)C=C)c1/C=C/COc1ccc(OC(=O)C=C)cc1 |
| InChI | InChI=1S/C37H30O9/c1-6-33(38)43-24-28-23-27(15-12-26-13-16-30(17-14-26)44-34(39)7-2)25(5)37(46-36(41)9-4)32(28)11-10-22-42-29-18-20-31(21-19-29)45-35(40)8-3/h6-11,13-14,16-21,23H,1-4,22,24H2,5H3/b11-10+ |
| InChIKey | HDUJRKAYLLKQSS-ZHACJKMWSA-N |
| XLogP | 5.99 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.64 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|